For research use only. Not for therapeutic Use.
Fraxidin（Cat No.:R006018）is a natural compound classified as a coumarin, commonly found in plants like ash trees (Fraxinus species). Known for its antioxidant, anti-inflammatory, and antifungal properties, fraxidin is studied for various health benefits. It works by scavenging free radicals, thus helping to protect cells from oxidative stress and inflammation. In traditional medicine, it has been used for its potential therapeutic effects on skin disorders, liver health, and immune support. Due to its bioactive properties, fraxidin is gaining attention in natural medicine and skincare formulations aimed at soothing and protecting the skin.
| Catalog Number | R006018 |
| CAS Number | 525-21-3 |
| Molecular Formula | C11H10O5 |
| Purity | ≥95% |
| Target | Bacterial |
| IUPAC Name | 8-hydroxy-6,7-dimethoxychromen-2-one |
| InChI | InChI=1S/C11H10O5/c1-14-7-5-6-3-4-8(12)16-10(6)9(13)11(7)15-2/h3-5,13H,1-2H3 |
| InChIKey | QNFBKOHHLAWWTC-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1)C=CC(=O)O2)O)OC |
