For research use only. Not for therapeutic Use.
FT671(Cat No.:I020325)is a small-molecule inhibitor being studied for its potential in treating various cancers. It specifically targets and inhibits the activity of the Bruton’s tyrosine kinase (BTK), a key enzyme involved in the B-cell receptor signaling pathway, which is crucial for the survival and proliferation of certain cancerous B-cells. By blocking BTK, FT671 may help to suppress tumor growth and improve the effectiveness of other cancer therapies. Preclinical and early clinical studies have shown promising results, and ongoing trials are focused on evaluating its safety, efficacy, and potential as a cancer treatment.
CAS Number | 1959551-26-8 |
Molecular Formula | C₂₄H₂₃F₄N₇O₃ |
Purity | ≥95% |
IUPAC Name | 5-[[1-[(3S)-4,4-difluoro-3-(3-fluoropyrazol-1-yl)butanoyl]-4-hydroxypiperidin-4-yl]methyl]-1-(4-fluorophenyl)pyrazolo[3,4-d]pyrimidin-4-one |
InChI | InChI=1S/C24H23F4N7O3/c25-15-1-3-16(4-2-15)35-22-17(12-30-35)23(37)33(14-29-22)13-24(38)6-9-32(10-7-24)20(36)11-18(21(27)28)34-8-5-19(26)31-34/h1-5,8,12,14,18,21,38H,6-7,9-11,13H2/t18-/m0/s1 |
InChIKey | BLSNYSFLZAWBIV-SFHVURJKSA-N |
SMILES | C1CN(CCC1(CN2C=NC3=C(C2=O)C=NN3C4=CC=C(C=C4)F)O)C(=O)C[C@@H](C(F)F)N5C=CC(=N5)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |