For research use only. Not for therapeutic Use.
FTO-IN-7(CAT: I032880) is a potent and selective inhibitor of FTO (Fat Mass and Obesity-associated protein), an m6A RNA demethylase involved in epigenetic regulation of gene expression. By inhibiting FTO’s demethylase activity, FTO-IN-7 modulates RNA methylation dynamics, influencing processes such as cell differentiation, metabolism, and tumor progression. It is especially valuable in cancer and metabolic disease research, where FTO plays a key role in oncogenic pathways and adipogenesis. FTO-IN-7 is widely used to explore RNA epigenetics and the therapeutic potential of targeting RNA modifications.
| CAS Number | 2243736-37-8 |
| Synonyms | 2-[2,6-dichloro-4-(3,5-dimethyl-1H-pyrazol-4-yl)anilino]benzoic acid |
| Molecular Formula | C18H15Cl2N3O2 |
| Purity | ≥95% |
| IUPAC Name | 2-[2,6-dichloro-4-(3,5-dimethyl-1H-pyrazol-4-yl)anilino]benzoic acid |
| InChI | InChI=1S/C18H15Cl2N3O2/c1-9-16(10(2)23-22-9)11-7-13(19)17(14(20)8-11)21-15-6-4-3-5-12(15)18(24)25/h3-8,21H,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | MCENODSHXUWMEL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)C2=CC(=C(C(=C2)Cl)NC3=CC=CC=C3C(=O)O)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
