For research use only. Not for therapeutic Use.
FTO-IN-7 is an inhibitor of FTO. FTO-IN-7 can be used in study Alzheimer’s diseases, breast cancers, small-cell lung cancers,a human bone marrow striated muscle cancer, a pancreatic cancer, malignant glioblastoma[1].
| Catalog Number | I032880 |
| CAS Number | 2243736-37-8 |
| Synonyms | 2-[2,6-dichloro-4-(3,5-dimethyl-1H-pyrazol-4-yl)anilino]benzoic acid |
| Molecular Formula | C18H15Cl2N3O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C18H15Cl2N3O2/c1-9-16(10(2)23-22-9)11-7-13(19)17(14(20)8-11)21-15-6-4-3-5-12(15)18(24)25/h3-8,21H,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | MCENODSHXUWMEL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)C2=CC(=C(C(=C2)Cl)NC3=CC=CC=C3C(=O)O)Cl |
| Reference | [1]. Yang, Caiguang, et al.Preparation of 2-substituted-benzene matrix |
