For research use only. Not for therapeutic Use.
FTO-IN-8（Cat No.:I043305）is a small molecule inhibitor that selectively targets the fat mass and obesity-associated protein (FTO), an RNA demethylase involved in regulating gene expression through RNA modifications. FTO is implicated in various metabolic processes, including obesity, diabetes, and cancer. FTO-IN-8 inhibits FTO’s activity, preventing the demethylation of m6A-modified RNA, which can alter RNA stability, splicing, and translation. This inhibitor has potential applications in research focused on gene regulation, RNA modifications, and diseases linked to FTO dysregulation. It is also being explored for its therapeutic potential in metabolic disorders and cancers.
| CAS Number | 2640366-38-5 |
| Synonyms | 1-[5-(2-chlorophenyl)furan-2-yl]-N-[(3-pyrrolidin-1-yloxetan-3-yl)methyl]methanamine |
| Molecular Formula | C19H23ClN2O2 |
| Purity | ≥95% |
| IUPAC Name | 1-[5-(2-chlorophenyl)furan-2-yl]-N-[(3-pyrrolidin-1-yloxetan-3-yl)methyl]methanamine |
| InChI | InChI=1S/C19H23ClN2O2/c20-17-6-2-1-5-16(17)18-8-7-15(24-18)11-21-12-19(13-23-14-19)22-9-3-4-10-22/h1-2,5-8,21H,3-4,9-14H2 |
| InChIKey | QHNARTNMADDQGU-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2(COC2)CNCC3=CC=C(O3)C4=CC=CC=C4Cl |
