For research use only. Not for therapeutic Use.
Fucoidan (Cat.No:R066748) is a sulfated polysaccharide found in various species of brown seaweed and algae that demonstrates anticancer, antiviral, neuroprotective, immune-modulating, and many additional diverse biological effects in animal models. It is reported to target natural thrombin inhibitors, P- and L-selectins, various complement enzymes, CD4 glycoproteins on T lymphocytes, digestive enzymes involved in the absorption of glucose, kinases that drive mitosis such as MAPK, caspases involved in apoptosis, angiogenesis-promoting HIF-1, NK cells, T cells, and dendritic cells. Fucoidan has also been studied for its potential use in nanosystem applications such as drug delivery or tissue engineering.
CAS Number | 9072-19-9 |
Synonyms | Fucan;Sulfated α-L-Fucan |
Molecular Formula | C7H14O7S |
Purity | ≥95% |
Target | Glucosidase |
Storage | -20°C |
InChI | InChI=1S/C8H16O7S/c1-4-7(13-3)6(9)8(5(2)14-4)15-16(10,11)12/h4-9H,1-3H3,(H,10,11,12)/t4-,5+,6+,7-,8-/m1/s1 |
InChIKey | WZPKXSSMRAQGAC-DWOUCZDBSA-N |
SMILES | C[C@]1([H])[C@@H](OC)[C@H](O)[C@H](OS(O)(=O)=O)[C@H](C)O1 |
Reference | 1.Ruocco, N.,Costantini, S.,Guariniello, S., et al. Polysaccharides from the marine environment with pharmacological, cosmeceutical and nutraceutical potential. Molecules 21(5), (2016). |