For research use only. Not for therapeutic Use.
Fullerite(Cat No.:M108698) is a synthetic material composed of a mixture of C60 and C70 fullerenes, spherical molecules made entirely of carbon. C60 fullerenes, also known as buckminsterfullerenes or “buckyballs,” consist of 60 carbon atoms forming a structure resembling a soccer ball, while C70 fullerenes have a more elongated, rugby ball-like shape with 70 carbon atoms. Fullerite exhibits unique properties such as high strength, electrical conductivity, and resistance to chemical reactions. These characteristics make it suitable for applications in nanotechnology, electronics, and materials science, where it can be used in superhard materials and conductive coatings.
CAS Number | 131159-39-2 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | (C60-Ih)[5,6]fullerene |
InChI | InChI=1S/C60/c1-2-5-6-3(1)8-12-10-4(1)9-11-7(2)17-21-13(5)23-24-14(6)22-18(8)28-20(12)30-26-16(10)15(9)25-29-19(11)27(17)37-41-31(21)33(23)43-44-34(24)32(22)42-38(28)48-40(30)46-36(26)35(25)45-39(29)47(37)55-49(41)51(43)57-52(44)50(42)56(48)59-54(46)53(45)58(55)60(57)59 |
InChIKey | XMWRBQBLMFGWIX-UHFFFAOYSA-N |
SMILES | C12=C3C4=C5C6=C1C7=C8C9=C1C%10=C%11C(=C29)C3=C2C3=C4C4=C5C5=C9C6=C7C6=C7C8=C1C1=C8C%10=C%10C%11=C2C2=C3C3=C4C4=C5C5=C%11C%12=C(C6=C95)C7=C1C1=C%12C5=C%11C4=C3C3=C5C(=C81)C%10=C23 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |