For research use only. Not for therapeutic Use.
Fumagillol(Cat No.:R018627)is a natural compound derived from the fermentation of Aspergillus fumigatus, known for its role as a precursor to fumagillin and related derivatives. It exhibits antimicrobial and antiparasitic properties, particularly in inhibiting microsporidian parasites. Structurally, Fumagillol contains a unique epoxy structure, contributing to its bioactivity and making it a valuable subject in drug development research, especially for targeting angiogenesis and immune modulation. Its potential applications extend to cancer and infectious disease studies, where it serves as a model for developing therapeutic agents with selective biological activities.
Catalog Number | R018627 |
CAS Number | 108102-51-8 |
Synonyms | (3R,4S,5S,6R)-5-Methoxy-4-[(2R,3R)-2-methyl-3-(3-methyl-2-buten-1-yl)-2-oxiranyl]-1-oxaspiro[2.5]octan-6-ol; (3R,4S,5S,6R)-5-Methoxy-4-[(2R,3R)-2-methyl-3-(3-methyl-2-butenyl)oxiranyl]-1-oxaspiro[2.5]octan-6-ol; [3R-[3α,4α(2R*,3R*),5β,6β]]-5-Methoxy- |
Molecular Formula | C16H26O4 |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | (3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ol |
InChI | InChI=1S/C16H26O4/c1-10(2)5-6-12-15(3,20-12)14-13(18-4)11(17)7-8-16(14)9-19-16/h5,11-14,17H,6-9H2,1-4H3/t11-,12-,13-,14-,15+,16+/m1/s1 |
InChIKey | CEVCTNCUIVEQOY-JQOWZUPLSA-N |
SMILES | CC(=CC[C@@H]1[C@@](O1)(C)[C@H]2[C@@H]([C@@H](CC[C@]23CO3)O)OC)C |