For research use only. Not for therapeutic Use.
Fumaric Acid-d4(Cat No.:M043630) is a high-purity deuterated compound essential for advanced biochemical and pharmaceutical research. Featuring four deuterium atoms, this isotopically labeled version of fumaric acid is crucial for studying metabolic pathways, enzyme interactions, and cellular respiration. It enhances the precision and accuracy of analytical techniques such as mass spectrometry and NMR spectroscopy, ensuring reliable and reproducible results. Ideal for drug development, metabolic studies, and biochemical research, Fumaric Acid-d4 integrates seamlessly into existing protocols, providing a robust and cost-effective solution for high-precision scientific investigations.
Catalog Number | M043630 |
CAS Number | 194160-45-7 |
Molecular Formula | C4H4O4 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | Desiccate at -20C |
IUPAC Name | dideuterio (E)-2,3-dideuteriobut-2-enedioate |
InChI | InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+/i1D,2D/hD2 |
InChIKey | VZCYOOQTPOCHFL-JXRVJRKUSA-N |
SMILES | [2H]/C(=C(/[2H])\C(=O)O[2H])/C(=O)O[2H] |