For research use only. Not for therapeutic Use.
Furamidine dihydrochloride(Cat No.:R057843)is a synthetic compound primarily studied for its antiprotozoal activity, particularly against Trypanosoma brucei, the causative agent of sleeping sickness. It functions as a potent inhibitor of nucleic acid synthesis, disrupting the parasite’s replication and survival. This compound has shown promise in preclinical studies, demonstrating efficacy in reducing parasitemia and improving survival rates in infected models. Additionally, furamidine’s ability to penetrate the blood-brain barrier enhances its therapeutic potential for central nervous system infections. Ongoing research aims to optimize its pharmacological properties and evaluate its effectiveness in treating related diseases.
Catalog Number | R057843 |
CAS Number | 55368-40-6 |
Synonyms | 4,4’-(2,5-Furandiyl)bisbenzenecarboximidamide Dihydrochloride; 2,5-Bis(4-amidinophenyl)furan Dihydrochloride; 2,5-Bis(4-guanylphenyl)furan Dihydrochloride; WR 199385 |
Molecular Formula | C18H16N4O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-[5-(4-carbamimidoylphenyl)furan-2-yl]benzenecarboximidamide;dihydrochloride |
InChI | InChI=1S/C18H16N4O.2ClH/c19-17(20)13-5-1-11(2-6-13)15-9-10-16(23-15)12-3-7-14(8-4-12)18(21)22;;/h1-10H,(H3,19,20)(H3,21,22);2*1H |
InChIKey | VXNYQUQHOUERTR-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1C2=CC=C(O2)C3=CC=C(C=C3)C(=N)N)C(=N)N.Cl.Cl |