Furan-2,4-dicarboxylic acid(Cat No.:M172339), also known as FDCA, is a chemical compound with the molecular formula C6H4O5. It is derived from furan, a heterocyclic compound, and contains two carboxylic acid groups attached to the furan ring at the 2 and 4 positions. FDCA is a versatile compound with potential applications as a bio-based building block for the production of polymers, such as polyethylene furoate (PEF), which is considered a renewable and biodegradable alternative to polyethylene terephthalate (PET).
Catalog Number | M172339 |
CAS Number | 4282-28-4 |
Molecular Formula | C6H4O5 |
Purity | 95% |
IUPAC Name | furan-2,4-dicarboxylic acid |
InChI | InChI=1S/C6H4O5/c7-5(8)3-1-4(6(9)10)11-2-3/h1-2H,(H,7,8)(H,9,10) |
InChIKey | JOTDFEIYNHTJHZ-UHFFFAOYSA-N |
SMILES | C1=C(OC=C1C(=O)O)C(=O)O |