Furaneol-13C2 is a doubly 13C-labeled version of Furaneol, a key flavor compound known for its sweet, caramel-like aroma, often found in strawberries, pineapples, and other fruits. This isotopically labeled compound is essential for studying the biosynthesis, metabolic pathways, and flavor profile development in food chemistry. The incorporation of two carbon-13 atoms allows for precise tracking and quantification using techniques like NMR spectroscopy and mass spectrometry. Furaneol-13C2 is widely used in research focused on food flavoring, aroma analysis, and the development of natural and synthetic flavor compounds, offering reliable data for both scientific investigations and industrial applications.
| Catalog Number | R071468 |
| CAS Number | NA |
| Synonyms | Furaneol – 13C2 |
| Molecular Formula | C6H8O3 |
| Purity | 0% |
| Solubility | Methanol |
| Related CAS | 3658-77-3 |
| IUPAC Name | 4-hydroxy-2-methyl-5-(113C)methyl(513C)furan-3-one |
| InChI | InChI=1S/C6H8O3/c1-3-5(7)6(8)4(2)9-3/h3,8H,1-2H3/i2+1,4+1 |
| InChIKey | INAXVXBDKKUCGI-NDLBAUGKSA-N |
| SMILES | CC1C(=O)C(=[13C](O1)[13CH3])O |
