For research use only. Not for therapeutic Use.
Furcatin(CAT: R013648) is a natural compound found in certain plants and fruits. Its action targets involve antioxidant and antimicrobial effects. The mode of action includes scavenging free radicals and inhibiting microbial growth. Pharmacologically, Furcatin demonstrates potential as an antioxidant agent, helping to neutralize harmful reactive oxygen species and protect cells from oxidative stress. Additionally, it exhibits antimicrobial properties that may be beneficial in combating certain bacterial and fungal infections. Its applications range from potential therapeutic use as an antioxidant supplement to being investigated as a natural preservative in food and cosmetic industries.
CAS Number | 499-33-2 |
Synonyms | 4-(2-Propen-1-yl)phenyl 6-O-D-Apio-β-D-furanosyl-β-D-glucopyranoside; p-Allylphenyl 6-O-β-D-apiofuranosyl-β-D-glucopyranoside |
Molecular Formula | C20H28O10 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2R,3S,4S,5R,6S)-2-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-(4-prop-2-enylphenoxy)oxane-3,4,5-triol |
InChI | InChI=1S/C20H28O10/c1-2-3-11-4-6-12(7-5-11)29-18-16(24)15(23)14(22)13(30-18)8-27-19-17(25)20(26,9-21)10-28-19/h2,4-7,13-19,21-26H,1,3,8-10H2/t13-,14-,15+,16-,17+,18-,19-,20-/m1/s1 |
InChIKey | HLTAEJNADMCLOV-LTRJMQNCSA-N |
SMILES | C=CCC1=CC=C(C=C1)OC2C(C(C(C(O2)COC3C(C(CO3)(CO)O)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |