For research use only. Not for therapeutic Use.
Furilazole(CAT: I000829) is a selective herbicide safener primarily used in agriculture to protect crops, especially corn (maize), from herbicide damage. It works by enhancing the plant’s natural detoxification processes, allowing crops to tolerate the application of certain chloroacetanilide herbicides (e.g., acetochlor and alachlor) without being harmed. Furilazole induces specific detoxification enzymes, such as glutathione S-transferases (GSTs), which metabolize and neutralize herbicidal compounds. Its selective protection supports effective weed control while safeguarding crop health. Furilazole plays a significant role in agrochemical research for developing safer and more efficient weed management strategies.
CAS Number | 121776-33-8 |
Molecular Formula | C11H13Cl2NO3 |
Purity | ≥95% |
Solubility | 10 mM in DMSO |
Storage | Room temperature |
IUPAC Name | 2,2-dichloro-1-[5-(furan-2-yl)-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone |
InChI | InChI=1S/C11H13Cl2NO3/c1-11(2)14(10(15)9(12)13)6-8(17-11)7-4-3-5-16-7/h3-5,8-9H,6H2,1-2H3 |
InChIKey | MCNOFYBITGAAGM-UHFFFAOYSA-N |
SMILES | CC1(N(CC(O1)C2=CC=CO2)C(=O)C(Cl)Cl)C |