For research use only. Not for therapeutic Use.
Furoin(CAT: I014391) is an organic compound derived from the condensation of furfural, featuring a 1,2-diketone functional group. It is commonly used as a reagent in organic synthesis and a precursor in the production of fine chemicals. Furoin is also valuable in research exploring renewable materials, as it is derived from biomass sources like agricultural waste. Its unique structure makes it a key intermediate in studying catalytic processes and reaction mechanisms. With high purity and versatility, Furoin serves as an essential tool in chemical, material science, and sustainable chemistry research.
Catalog Number | I014391 |
CAS Number | 552-86-3 |
Synonyms | Furoin; NSC 18522; NSC-18522; NSC18522;EthaNA, 1,2-di-2-furanyl-2-hydroxy- |
Molecular Formula | C10H8O4 |
Purity | ≥95% |
Solubility | Soluble in DMSO |
IUPAC Name | 1,2-bis(furan-2-yl)-2-hydroxyethanone |
InChI | InChI=1S/C10H8O4/c11-9(7-3-1-5-13-7)10(12)8-4-2-6-14-8/h1-6,9,11H |
InChIKey | MIJRFWVFNKQQDK-UHFFFAOYSA-N |
SMILES | OC(C1=CC=CO1)C(C2=CC=CO2)=O |