For research use only. Not for therapeutic Use.
Fursultiamine(CAT: I012623) is a synthetic derivative of thiamine (vitamin B1) designed to enhance the bioavailability and therapeutic effects of thiamine. It is particularly known for its ability to cross cell membranes more effectively than thiamine itself, making it a valuable compound in treating conditions related to thiamine deficiency, such as beriberi and Wernicke-Korsakoff syndrome. Fursultiamine also exhibits neuroprotective properties, making it useful in neurological research and the management of neurodegenerative diseases. Additionally, its role in improving energy metabolism and reducing fatigue has garnered interest in sports science and general health applications. Researchers and clinicians use Fursultiamine to explore its potential benefits in metabolic, neurological, and cardiovascular health.
| Catalog Number | I012623 |
| CAS Number | 804-30-8 |
| Synonyms | N-[(4-amino-2-methylpyrimidin-5-yl)methyl]-N-[(E)-5-hydroxy-3-(oxolan-2-ylmethyldisulfanyl)pent-2-en-2-yl]formamide |
| Molecular Formula | C17H26N4O3S2 |
| Purity | ≥95% |
| IUPAC Name | N-[(4-amino-2-methylpyrimidin-5-yl)methyl]-N-[(E)-5-hydroxy-3-(oxolan-2-ylmethyldisulfanyl)pent-2-en-2-yl]formamide |
| InChI | InChI=1S/C17H26N4O3S2/c1-12(16(5-6-22)26-25-10-15-4-3-7-24-15)21(11-23)9-14-8-19-13(2)20-17(14)18/h8,11,15,22H,3-7,9-10H2,1-2H3,(H2,18,19,20)/b16-12+ |
| InChIKey | JTLXCMOFVBXEKD-FOWTUZBSSA-N |
| SMILES | CC1=NC=C(C(=N1)N)CN(C=O)C(=C(CCO)SSCC2CCCO2)C |
