For research use only. Not for therapeutic Use.
Furyl Hydroxymethyl Ketone(Cat No.:R022383)is a high-purity organic compound commonly used in flavor and fragrance industries due to its sweet, caramel-like aroma. It is an important intermediate in the synthesis of various fine chemicals and specialty compounds, contributing to the creation of complex flavors and scents. Additionally, Furyl Hydroxymethyl Ketone is utilized in pharmaceutical research for developing new therapeutic agents. Its unique chemical structure and reactivity make it valuable for advancing studies in organic synthesis, enhancing product formulations, and exploring novel applications in both industrial and scientific contexts.
CAS Number | 17678-19-2 |
Synonyms | 2-Furyl Hydroxymethyl Ketone; 1-(2-Furanyl)-2-hydroxyethanone; 2-(1-Oxo-2-hydroxyethyl)furan; 2-(2’-Hydroxyacetyl)furan; 2-(Hydroxyacetyl)furan; 2-Furyl hydroxymethyl Ketone |
Molecular Formula | C6H6O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1-(furan-2-yl)-2-hydroxyethanone |
InChI | InChI=1S/C6H6O3/c7-4-5(8)6-2-1-3-9-6/h1-3,7H,4H2 |
InChIKey | RSZZMVPSHLKFQY-UHFFFAOYSA-N |
SMILES | C1=COC(=C1)C(=O)CO |