For research use only. Not for therapeutic Use.
Fusaric acid(CAT: R029902) is a natural pyridine derivative produced by various Fusarium species. This compound is known for its broad range of biological activities, including antimicrobial, phytotoxic, and cytotoxic effects. In pharmaceutical research, fusaric acid is studied for its potential as an inhibitor of dopamine beta-hydroxylase, making it relevant in neurological and cardiovascular studies. Additionally, it serves as a precursor for developing bioactive derivatives. With its unique structure and biological properties, Fusaric acid is widely utilized in medicinal chemistry, agricultural research, and biochemical studies to explore innovative therapeutic and agrochemical applications.
Catalog Number | R029902 |
CAS Number | 536-69-6 |
Synonyms | 5-butylpyridine-2-carboxylic acid |
Molecular Formula | C10H13NO2 |
Purity | ≥95% |
IUPAC Name | (3-bromopyridin-2-yl)methanol |
InChI | InChI=1S/C10H13NO2/c1-2-3-4-8-5-6-9(10(12)13)11-7-8/h5-7H,2-4H2,1H3,(H,12,13) |
InChIKey | DGMPVYSXXIOGJY-UHFFFAOYSA-N |
SMILES | CCCCC1=CN=C(C=C1)C(=O)O |