For research use only. Not for therapeutic Use.
G9a-IN-1 (Compound 113) is a G9a protein inhibitor. G9A/EHMT2 is a nuclear histone lysine methyltransferase that catalyzes histone H3 lysine 9 dimethylation (H3K9me2), which is a reversible modification generally associated with transcriptional gene silencing. G9a-IN-1 can be used for the research of autoimmune disorders or cancer[1].
| Catalog Number | I020984 |
| CAS Number | 1350752-07-6 |
| Synonyms | 2-chloro-6-methoxy-N-(1-propan-2-ylpiperidin-4-yl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine |
| Molecular Formula | C24H36ClN5O2 |
| Purity | ≥95% |
| InChI | InChI=1S/C24H36ClN5O2/c1-17(2)30-12-7-18(8-13-30)26-23-19-15-21(31-3)22(16-20(19)27-24(25)28-23)32-14-6-11-29-9-4-5-10-29/h15-18H,4-14H2,1-3H3,(H,26,27,28) |
| InChIKey | GHTIAKXLWWMKSI-UHFFFAOYSA-N |
| SMILES | CC(C)N1CCC(CC1)NC2=NC(=NC3=CC(=C(C=C32)OC)OCCCN4CCCC4)Cl |
| Reference | [1]. Dimitrios Iliopoulos, et al. Small molecules for the treatment of autoimmune diseases and cancer. WO2022031939A1 |
