For research use only. Not for therapeutic Use.
Gadodiamide（Cat No.:I001204）is a gadolinium-based contrast agent used in magnetic resonance imaging (MRI) to enhance the visibility of internal body structures. Administered intravenously, it improves the clarity and detail of MRI scans by altering the magnetic properties of nearby water molecules, thereby providing better differentiation between normal and abnormal tissues. Its high safety profile and efficacy make it a preferred choice for diagnosing various conditions, including tumors, vascular diseases, and central nervous system disorders. Gadodiamide plays a crucial role in advancing diagnostic imaging and patient care.
| Catalog Number | I001204 |
| CAS Number | 131410-48-5 |
| Synonyms | 2-[bis[2-[carboxylatomethyl-[2-(methylamino)-2-oxoethyl]amino]ethyl]amino]acetate;gadolinium(3+) |
| Molecular Formula | C16H26GdN5O8 |
| Purity | ≥95% |
| IUPAC Name | 2-[bis[2-[carboxylatomethyl-[2-(methylamino)-2-oxoethyl]amino]ethyl]amino]acetate;gadolinium(3+) |
| InChI | InChI=1S/C16H29N5O8.Gd/c1-17-12(22)7-20(10-15(26)27)5-3-19(9-14(24)25)4-6-21(11-16(28)29)8-13(23)18-2;/h3-11H2,1-2H3,(H,17,22)(H,18,23)(H,24,25)(H,26,27)(H,28,29);/q;+3/p-3 |
| InChIKey | HZHFFEYYPYZMNU-UHFFFAOYSA-K |
| SMILES | CNC(=O)CN(CCN(CCN(CC(=O)NC)CC(=O)[O-])CC(=O)[O-])CC(=O)[O-].[Gd+3] |
