For research use only. Not for therapeutic Use.
Galactinol is a biochemical reagent. Galactinol scavenges hydroxyl radicals and protects plant cells from oxidative damage[1].
| Catalog Number | I041632 |
| CAS Number | 3687-64-7 |
| Synonyms | (1S,2S,4R,5S)-6-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexane-1,2,3,4,5-pentol |
| Molecular Formula | C12H22O11 |
| Purity | ≥95% |
| InChI | InChI=1S/C12H22O11/c13-1-2-3(14)4(15)10(21)12(22-2)23-11-8(19)6(17)5(16)7(18)9(11)20/h2-21H,1H2/t2-,3+,4+,5?,6-,7+,8+,9+,10-,11?,12-/m1/s1 |
| InChIKey | VCWMRQDBPZKXKG-ZNVDUFQESA-N |
| SMILES | C(C1C(C(C(C(O1)OC2C(C(C(C(C2O)O)O)O)O)O)O)O)O |
| Reference | [1]. Nishizawa A, et al. Galactinol and raffinose constitute a novel function to protect plants from oxidative damage. Plant Physiol. 2008 Jul;147(3):1251-63. |
