Home
>
Isotope Labeled Compounds>Isotope Labeled Inhibitors> Galanthamine-O-(methyl-d3)-N-(methyl-d3)
For research use only. Not for therapeutic Use.
Galanthamine-O-(methyl-d3)-N-(methyl-d3)(CAT: R009216) is a deuterium-labeled derivative of galanthamine, an alkaloid found in various plants, including snowdrops and daffodils. Its mode of action involves being a labeled form of galanthamine, a cholinesterase inhibitor that is used in the treatment of Alzheimer’s disease and other cognitive disorders. Pharmacologically, Galanthamine-O-(methyl-d3)-N-(methyl-d3) is not used as a therapeutic drug on its own. Instead, it serves as a labeled internal standard in analytical chemistry and bioanalytical studies. By using deuterium-labeled compounds like Galanthamine-O-(methyl-d3)-N-(methyl-d3) as internal standards, researchers can accurately quantify and identify galanthamine and related compounds in complex samples using various analytical techniques, such as mass spectrometry.
Catalog Number | R009216 |
CAS Number | 1128109-00-1 |
Synonyms | (4aS,6R,8aS)-4a,5,9,10,11,12-Hexahydro-3-(methoxy-d3)-11-(methyl-d3)-6H-benzofurol[3a,3,2,-ef][2]benzazepin-6-ol; BRN 0093736-d6; Galantamin-d6; Galantamina-d6; Galantamine-d6; (-)-Galanthamine-d6; Jilkon-d6; Lycoremin-d6; Lycoremine-d6; NSC 100058-d |
Molecular Formula | C17H21NO3 |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | (1S,12S,14R)-9-(trideuteriomethoxy)-4-(trideuteriomethyl)-11-oxa-4-azatetracyclo[8.6.1.01,12.06,17]heptadeca-6(17),7,9,15-tetraen-14-ol |
InChI | InChI=1S/C17H21NO3/c1-18-8-7-17-6-5-12(19)9-14(17)21-16-13(20-2)4-3-11(10-18)15(16)17/h3-6,12,14,19H,7-10H2,1-2H3/t12-,14-,17-/m0/s1/i1D3,2D3 |
InChIKey | ASUTZQLVASHGKV-BQBSLYESSA-N |
SMILES | [2H]C([2H])([2H])N1CC[C@@]23C=C[C@@H](C[C@@H]2OC4=C(C=CC(=C34)C1)OC([2H])([2H])[2H])O |