For research use only. Not for therapeutic Use.
Gallacetophenone 3’,4’-Dimethyl Ether is a synthetic organic compound derived from gallacetophenone. It features two methyl groups attached to the aromatic ring, which can affect its chemical properties and potential applications. This compound is studied for its potential use in pharmaceuticals, flavorings, and fragrance formulations, offering diverse benefits in chemical and industrial research.
CAS Number | 5396-18-9 |
Synonyms | 1-(2-Hydroxy-3,4-dimethoxyphenyl)ethanone; 2’-Hydroxy-3’,4’-dimethoxyacetophenone; 3,4-Dimethoxy-2-hydroxyacetophenone; 3’,4’-Dimethoxy-2’-hydroxyacetophenone; Gallacetophenone-3,4-O-dimethyl Ether; NSC 1181; |
Molecular Formula | C10H12O4 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1-(2-hydroxy-3,4-dimethoxyphenyl)ethanone |
InChI | InChI=1S/C10H12O4/c1-6(11)7-4-5-8(13-2)10(14-3)9(7)12/h4-5,12H,1-3H3 |
InChIKey | BCEPNLMYVYJIHU-UHFFFAOYSA-N |
SMILES | CC(=O)C1=C(C(=C(C=C1)OC)OC)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |