For research use only. Not for therapeutic Use.
Gallic Acid Monohydrate (Cat.No:R058196) is a natural phenolic compound found in various plant sources, including fruits, nuts, and leaves. It possesses antioxidant, anti-inflammatory, and antiproliferative properties. Gallic Acid Monohydrate has potential health benefits and is being studied for its role in preventing oxidative stress-related diseases and its therapeutic applications in various conditions.
Catalog Number | R058196 |
CAS Number | 5995-86-8 |
Synonyms | 3,4,5-Trihydroxybenzoic Acid Hydrate; 3,4,5-Trihydroxybenzoic Acid Monohydrate; |
Molecular Formula | C7H8O6 |
Purity | ≥95% |
Target | NF-κB |
Storage | -20°C |
IUPAC Name | 3,4,5-trihydroxybenzoic acid;hydrate |
InChI | InChI=1S/C7H6O5.H2O/c8-4-1-3(7(11)12)2-5(9)6(4)10;/h1-2,8-10H,(H,11,12);1H2 |
InChIKey | IUTKPPDDLYYMBE-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1O)O)O)C(=O)O.O |