For research use only. Not for therapeutic Use.
Gallocyanine chloride（Cat No.:M050708）is a synthetic dye commonly used in histological and biological research to stain cells and tissues. It binds to nucleic acids, particularly DNA, and exhibits strong absorbance properties, allowing researchers to visualize cellular structures under a microscope. Gallocyanine chloride is often employed in the study of cell morphology, protein-DNA interactions, and cellular processes like apoptosis or mitosis. Due to its ability to selectively stain nucleic acids, it is particularly useful in studies requiring detailed visualization of cell nuclei. Its role in molecular biology extends to nucleic acid quantification and other diagnostic applications.
| CAS Number | 1562-85-2 |
| Synonyms | 7-(dimethylamino)-4-hydroxy-3-oxophenoxazin-10-ium-1-carboxylic acid;chloride |
| Molecular Formula | C15H13ClN2O5 |
| Purity | ≥95% |
| IUPAC Name | 7-(dimethylamino)-4-hydroxy-3-oxophenoxazin-10-ium-1-carboxylic acid;chloride |
| InChI | InChI=1S/C15H12N2O5.ClH/c1-17(2)7-3-4-9-11(5-7)22-14-12(16-9)8(15(20)21)6-10(18)13(14)19;/h3-6,19H,1-2H3,(H,20,21);1H |
| InChIKey | AQSOTOUQTVJNMY-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)[NH+]=C3C(=CC(=O)C(=C3O2)O)C(=O)O.[Cl-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
