For research use only. Not for therapeutic Use.
Galloflavin is an inhibitor of both the A and B isoforms of lactate dehydrogenase (K<sub>i</sub>s = 5.46 and 15.06 µM, respectively). It has been shown to prevent proliferation of many different cancer cell lines <em>in vitro</em> by blocking glycolysis and ATP production.
| Catalog Number | R040667 |
| CAS Number | 568-80-9 |
| Synonyms | 3,8,9,10-Tetrahydroxypyrano[3,2-c][2]benzopyran-2,6-dione; NSC 107022 |
| Molecular Formula | C12H6O8 |
| Purity | ≥95% |
| Target | Lactate Dehydrogenase |
| Storage | -20°C |
| IUPAC Name | 3,8,9,10-tetrahydroxypyrano[3,2-c]isochromene-2,6-dione |
| InChI | InChI=1S/C12H6O8/c13-4-1-3-7(9(16)8(4)15)10-6(19-11(3)17)2-5(14)12(18)20-10/h1-2,13-16H |
| InChIKey | VYKVZHXHVUVABA-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=C1O)O)O)C3=C(C=C(C(=O)O3)O)OC2=O |
