For research use only. Not for therapeutic Use.
Galnon trifluoroacetate salt（Cat No.:I027918）, is a synthetic small molecule that acts as a selective agonist for the galanin receptor 3 (GalR3). It is a trifluoroacetate salt form of a gallon, which specifically targets and activates GalR3 receptors. GalR3 receptors are a subtype of galanin receptors found in the central nervous system. By selectively activating GalR3 receptors, gallon trifluoroacetate salt can modulate various physiological processes, making it a valuable tool in research for investigating the functions and potential therapeutic applications of GalR3 signaling.
| Catalog Number | I027918 |
| CAS Number | 1217448-19-5 |
| Synonyms | Galnon trifluoroacetate salt, Galnon TFA |
| Molecular Formula | C42H47F3N4O8 |
| Purity | 98% |
| Target | Neuronal Signaling |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | −20°C |
| IUPAC Name | 3-cyclohexyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-alanyl-N-(4-methyl-2-oxo-2H-1-benzopyran-7-yl)-L-lysinamide, trifluoroacetate salt |
| InChI | InChI=1S/C40H46N4O6.C2HF3O2/c1-25-21-37(45)50-36-23-27(18-19-28(25)36)44(35(38(42)46)17-9-10-20-41)39(47)34(22-26-11-3-2-4-12-26)43-40(48)49-24-33-31-15-7-5-13-29(31)30-14-6-8-16-32(30)33;3-2(4,5)1(6)7/h5-8,13-16,18-19,21,23,26,33-35H,2-4,9-12,17,20,22,24,41H2,1H3,(H2,42,46)(H,43,48);(H,6,7)/t34-,35-;/m0./s1 |
| InChIKey | MTMBHUMNSQJCNR-WDAFUDAASA-N |
| SMILES | NCCCC[C@@H](C(N)=O)N(C([C@H](CC1CCCCC1)NC(OCC2C3=C(C4=C2C=CC=C4)C=CC=C3)=O)=O)C5=CC=C(C(O6)=C5)C(C)=CC6=O.O=C(O)C(F)(F)F |
| Reference | 1: Saar, K., Mazarati, A.M., Mahlapuu, R., et al. Anticonvulsant activity of a nonpeptide galanin receptor agonist. Proc. Natl. Acad. Sci. USA 99(10), 7136-7141 (2002). |
