For research use only. Not for therapeutic Use.
Gamma-caprolactone (CAT: L000246) is a versatile compound with applications in various fields, including material and organic chemistry. In material chemistry, it serves as a crucial monomer for the synthesis of biodegradable polymers, such as polycaprolactone (PCL). PCL has applications in drug delivery systems, tissue engineering, and biodegradable plastics. In organic chemistry, gamma-caprolactone is used to create a wide range of organic compounds.
| Catalog Number | L000246 |
| CAS Number | 2305-05-7 |
| Molecular Formula | C6H10O2 |
| Purity | ≥95% |
| IUPAC Name | 5-ethyloxolan-2-one |
| InChI | InChI=1S/C6H10O2/c1-2-5-3-4-6(7)8-5/h5H,2-4H2,1H3 |
| InChIKey | JBFHTYHTHYHCDJ-UHFFFAOYSA-N |
