For research use only. Not for therapeutic Use.
Gamma-glutamyl-1-amino-D-proline (Cat No.:M122181) is a synthetic dipeptide with potential antineoplastic activity. It consists of the amino acid D-proline linked to gamma-glutamic acid. GP-1 inhibits the enzyme gamma-glutamyl transpeptidase (GGT), which plays a crucial role in glutathione metabolism. By inhibiting GGT, GP-1 may deplete cellular glutathione levels, leading to oxidative stress and ultimately cell death in cancer cells. This compound is being studied for its potential in cancer treatment, particularly in combination with other therapies.
Catalog Number | M122181 |
CAS Number | 10139-06-7 |
Molecular Formula | C10H17N3O5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2R)-1-[[(4S)-4-amino-4-carboxybutanoyl]amino]pyrrolidine-2-carboxylic acid |
InChI | InChI=1S/C10H17N3O5/c11-6(9(15)16)3-4-8(14)12-13-5-1-2-7(13)10(17)18/h6-7H,1-5,11H2,(H,12,14)(H,15,16)(H,17,18)/t6-,7+/m0/s1 |
InChIKey | KWWHDNLMGLRNRN-NKWVEPMBSA-N |
SMILES | C1CC(N(C1)NC(=O)CCC(C(=O)O)N)C(=O)O |