For research use only. Not for therapeutic Use.
Gamma-secretase modulators (Cat No.:I005574) are compounds that regulate the activity of gamma-secretase, an enzyme complex involved in the cleavage of amyloid precursor protein (APP) to produce amyloid-beta (Aβ) peptides. These modulators specifically alter gamma-secretase activity to reduce the production of harmful Aβ aggregates, which are associated with Alzheimer’s disease and other neurodegenerative conditions. Unlike gamma-secretase inhibitors, which block the enzyme entirely, GSMs aim to selectively modulate its activity, potentially reducing Aβ levels without disrupting other essential gamma-secretase functions, making them promising candidates for Alzheimer’s disease treatment.
| Catalog Number | I005574 |
| CAS Number | 937812-80-1 |
| Synonyms | (4R,7E,9aS)-7-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)-1,3,4,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-6-one |
| Molecular Formula | C26H24F3N3O3 |
| Purity | ≥95% |
| Target | Amyloid-β |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | (4R,7E,9aS)-7-[[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]methylidene]-4-(3,4,5-trifluorophenyl)-1,3,4,8,9,9a-hexahydropyrido[2,1-c][1,4]oxazin-6-one |
| InChI | InChI=1S/C26H24F3N3O3/c1-15-11-31(14-30-15)22-6-3-16(8-24(22)34-2)7-17-4-5-19-12-35-13-23(32(19)26(17)33)18-9-20(27)25(29)21(28)10-18/h3,6-11,14,19,23H,4-5,12-13H2,1-2H3/b17-7+/t19-,23-/m0/s1 |
| InChIKey | VHNYOQKVZQVBLC-RTCGXNAVSA-N |
| SMILES | CC1=CN(C=N1)C2=C(C=C(C=C2)/C=C/3\CC[C@H]4COC[C@H](N4C3=O)C5=CC(=C(C(=C5)F)F)F)OC |
| Reference | <p> |
