For research use only. Not for therapeutic Use.
Ganoderenic acid D (Cat.No:M004705) is a triterpenoid compound derived from the Ganoderma lucidum mushroom. It exhibits potential anticancer, anti-inflammatory, and immunomodulatory effects. Ganoderenic acid D has attracted interest in herbal medicine and drug research due to its diverse pharmacological properties, offering avenues for therapeutic exploration.
| Catalog Number | M004705 |
| CAS Number | 100665-43-8 |
| Molecular Formula | C30H40O7 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | Store at -20℃ |
| IUPAC Name | 6-(7-hydroxy-4,4,10,13,14-pentamethyl-3,11,15-trioxo-1,2,5,6,7,12,16,17-octahydrocyclopenta[a]phenanthren-17-yl)-2-methyl-4-oxohept-5-enoic acid |
| InChI | InChI=1S/C30H40O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h10,16,18-19,21,32H,8-9,11-14H2,1-7H3,(H,36,37) |
| InChIKey | JGWQYLZHPPFHEH-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)C=C(C)C1CC(=O)C2(C1(CC(=O)C3=C2C(CC4C3(CCC(=O)C4(C)C)C)O)C)C)C(=O)O |
