For research use only. Not for therapeutic Use.
Ganoderic Acid B(Cat No.:R018926)is a triterpenoid compound derived from Ganoderma lucidum (Reishi mushroom), renowned for its medicinal properties. It exhibits a range of pharmacological activities, including anticancer, anti-inflammatory, antioxidant, and hepatoprotective effects. Ganoderic Acid B works by modulating signaling pathways such as NF-κB, PI3K/Akt, and apoptosis-related mechanisms, making it a valuable candidate in cancer and chronic disease research. Its ability to protect liver cells and regulate immune responses highlights its therapeutic potential. Ganoderic Acid B is widely studied in natural product research and drug discovery for its bioactive properties.
CAS Number | 81907-61-1 |
Synonyms | (3β,7β,25R)-3,7-Dihydroxy-11,15,23-trioxolanost-8-en-26-oic Acid |
Molecular Formula | C30H44O7 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | Store at -20°C |
IUPAC Name | (2R,6R)-6-[(3S,5R,7S,10S,13R,14R,17R)-3,7-dihydroxy-4,4,10,13,14-pentamethyl-11,15-dioxo-2,3,5,6,7,12,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-4-oxoheptanoic acid |
InChI | InChI=1S/C30H44O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h15-16,18-19,21-22,32,34H,8-14H2,1-7H3,(H,36,37)/t15-,16-,18-,19+,21+,22+,28+,29-,30+/m1/s1 |
InChIKey | LWPLEHFGBRFRKI-NBCWKOIPSA-N |
SMILES | C[C@H](CC(=O)C[C@@H](C)C(=O)O)[C@H]1CC(=O)[C@@]2([C@@]1(CC(=O)C3=C2[C@H](C[C@@H]4[C@@]3(CC[C@@H](C4(C)C)O)C)O)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |