For research use only. Not for therapeutic Use.
Ganoderic acid D（Cat No.:I018564）is a bioactive triterpenoid compound derived from the medicinal mushroom Ganoderma lucidum, commonly known as reishi. Known for its diverse pharmacological properties, ganoderic acid D exhibits anti-inflammatory, antioxidant, and hepatoprotective effects. Research suggests it may also have anticancer properties, as it can induce apoptosis in various cancer cell lines and inhibit tumor growth. Additionally, it has been studied for its potential to modulate immune responses and improve overall health. Its traditional use in herbal medicine, combined with modern scientific findings, underscores its therapeutic potential.
| Catalog Number | I018564 |
| CAS Number | 108340-60-9 |
| Molecular Formula | C₃₀H₄₂O₇ |
| Purity | ≥95% |
| IUPAC Name | (6R)-6-[(5R,7S,10S,13R,14R,17R)-7-hydroxy-4,4,10,13,14-pentamethyl-3,11,15-trioxo-1,2,5,6,7,12,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-2-methyl-4-oxoheptanoic acid |
| InChI | InChI=1S/C30H42O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h15-16,18-19,21,32H,8-14H2,1-7H3,(H,36,37)/t15-,16?,18-,19+,21+,28+,29-,30+/m1/s1 |
| InChIKey | YTVGSCZIHGRVAV-IYAQLQCNSA-N |
| SMILES | C[C@H](CC(=O)CC(C)C(=O)O)[C@H]1CC(=O)[C@@]2([C@@]1(CC(=O)C3=C2[C@H](C[C@@H]4[C@@]3(CCC(=O)C4(C)C)C)O)C)C |
| Reference | [1]. Liu Z, et al. Effect of ganoderic acid D on colon cancer Warburg effect: Role of SIRT3/cyclophilin D. Eur J Pharmacol. 2018 Apr 5;824:72-77.<br>[2]. Yue QX, et al. Proteomics characterization of the cytotoxicity mechanism of ganoderic acid D and computer-automated estimation of the possible drug target network. Mol Cell Proteomics. 2008 May;7(5):949-61. |
