For research use only. Not for therapeutic Use.
GANODERIC ACID DM(CAT: M038579) is a triterpenoid compound derived from the medicinal mushroom Ganoderma lucidum, also known as Lingzhi or Reishi. Its mode of action involves various biological activities, including antioxidant, anti-inflammatory, and immunomodulatory effects. Pharmacologically, GANODERIC ACID DM has been studied for its potential therapeutic applications in traditional medicine systems, particularly in traditional Chinese medicine. It has shown promise in various preclinical studies, demonstrating its potential in managing oxidative stress, reducing inflammation, and enhancing the immune system.
CAS Number | 173075-45-1 |
Molecular Formula | C30H44O4 |
Purity | ≥95% |
Target | PI3K/Akt/mTOR |
Storage | Store at RT |
IUPAC Name | (E,6R)-2-methyl-6-[(5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-3,7-dioxo-2,5,6,11,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]hept-2-enoic acid |
InChI | 1S/C30H44O4/c1-18(9-8-10-19(2)26(33)34)20-11-16-30(7)25-21(12-15-29(20,30)6)28(5)14-13-24(32)27(3,4)23(28)17-22(25)31/h10,18,20,23H,8-9,11-17H2,1-7H3,(H,33,34)/b19-10+/t18-,20-,23+,28-,29-,30+/m1/s1 |
InChIKey | ZTKZZRIVAYGFSF-PIPDTRPPSA-N |
SMILES | C[C@H](CC/C=C(\C)/C(=O)O)[C@H]1CC[C@@]2([C@@]1(CCC3=C2C(=O)C[C@@H]4[C@@]3(CCC(=O)C4(C)C)C)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |