For research use only. Not for therapeutic Use.
Ganoderic acid E is a triterpenoid found in Ganoderma lucidum[1].
| Catalog Number | I044966 |
| CAS Number | 98665-14-6 |
| Synonyms | (2R,6R)-2-methyl-4-oxo-6-[(5R,10S,13R,14R,17R)-4,4,10,13,14-pentamethyl-3,7,11,15-tetraoxo-2,5,6,12,16,17-hexahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid |
| Molecular Formula | C30H40O7 |
| Purity | ≥95% |
| InChI | InChI=1S/C30H40O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h15-16,18,21H,8-14H2,1-7H3,(H,36,37)/t15-,16-,18-,21+,28+,29-,30+/m1/s1 |
| InChIKey | VBGDQDJVTLQGNO-JXLWEQSJSA-N |
| SMILES | CC(CC(=O)CC(C)C(=O)O)C1CC(=O)C2(C1(CC(=O)C3=C2C(=O)CC4C3(CCC(=O)C4(C)C)C)C)C |
| Reference | [1]. Kikuchi T, et al. Ganoderic acid D, E, F, and H and lucidenic acid D, E, and F, new triterpenoids from Ganoderma lucidum[J]. Chem.pharm.bull, 2008, 33(6):2624-2627. |
