For research use only. Not for therapeutic Use.
Ganodermatriol(Cat No.:M008712) is a triterpenoid compound extracted from Ganoderma lucidum, a species of medicinal mushroom commonly known as reishi or lingzhi. This bioactive compound is part of a group of substances in reishi mushrooms known for their potential health benefits. Ganodermatriol has been studied for its anti-inflammatory, antioxidant, and anti-tumor properties. It is believed to help modulate the immune system and may also have potential in cancer therapy, particularly in inhibiting the growth of cancer cells.
CAS Number | 105300-28-5 |
Molecular Formula | C30H48O3 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 2-[(4R)-4-[(3S,5R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,12,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]pentylidene]propane-1,3-diol |
InChI | InChI=1S/C30H48O3/c1-20(8-7-9-21(18-31)19-32)22-12-16-30(6)24-10-11-25-27(2,3)26(33)14-15-28(25,4)23(24)13-17-29(22,30)5/h9-10,13,20,22,25-26,31-33H,7-8,11-12,14-19H2,1-6H3/t20-,22-,25+,26+,28-,29-,30+/m1/s1 |
InChIKey | LIJZGBVDQCTWLG-RVFLQCAWSA-N |
SMILES | CC(CCC=C(CO)CO)C1CCC2(C1(CC=C3C2=CCC4C3(CCC(C4(C)C)O)C)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |