For research use only. Not for therapeutic Use.
Garamine Triacetate Salt is a derivative of garamine, a naturally occurring alkaloid found in certain plants, known for its biological activity. The triacetate form enhances its solubility and stability, making it more suitable for pharmaceutical and biochemical research. Garamine Triacetate Salt has been studied for its potential pharmacological effects, including antimicrobial, antimalarial, and anti-inflammatory properties. Its role as a bioactive compound makes it a valuable candidate for further investigation in drug discovery and development, particularly for its therapeutic potential in treating infectious diseases and inflammation-related conditions.
CAS Number | 49751-51-1 |
Synonyms | 2-Deoxy-6-O-[3-deoxy-4-C-methyl-3-(methylamino)-β-L-arabinopyranosyl]-D-streptamine Triacetate; |
Molecular Formula | C13H27N3O6 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2R,3R,4R,5R)-2-[(1S,2S,3R,4S,6R)-4,6-diamino-2,3-dihydroxycyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol |
InChI | InChI=1S/C13H27N3O6/c1-13(20)4-21-12(9(19)11(13)16-2)22-10-6(15)3-5(14)7(17)8(10)18/h5-12,16-20H,3-4,14-15H2,1-2H3/t5-,6+,7+,8-,9+,10-,11+,12+,13-/m0/s1 |
InChIKey | ONKJLIUSEXIAKL-QUDADGMASA-N |
SMILES | CC1(COC(C(C1NC)O)OC2C(CC(C(C2O)O)N)N)O |