For research use only. Not for therapeutic Use.
Garcinol (CAT: I011871) is a natural polyisoprenylated benzophenone derivative found in Garcinia indica, a plant native to Southeast Asia. It possesses diverse pharmacological activities, including antioxidant, anti-inflammatory, and anticancer properties. Garcinol exerts its effects through multiple mechanisms, such as modulation of transcription factors, inhibition of enzyme activity, and regulation of cellular signaling pathways. It has shown potential as a chemopreventive and chemotherapeutic agent, inhibiting the growth of various cancer cell lines and inducing apoptosis. Garcinol’s antioxidant and anti-inflammatory properties also make it a promising candidate for the treatment of oxidative stress-related diseases and inflammatory conditions.
| Catalog Number | I011871 |
| CAS Number | 78824-30-3 |
| Synonyms | (1R,5R,7R)-3-(3,4-Dihydroxybenzoyl)-4-hydroxy-8,8-dimethyl-1,7-bis(3-methyl-2-butenyl)-5-[(2S)-5-methyl-2-(1-methylethenyl)-4-hexenyl]-bicyclo[3.3.1]non-3-ene-2,9-dione; [1R-[1α,5α,5(S*),7β]]-3-(3,4-Dihydroxybenzoyl)-4-hydroxy-8,8-dimethyl-1,7-bis(3- |
| Molecular Formula | C₃₈H₅₀O₆ |
| Purity | ≥95% |
| Target | Histone Acetyltransferases |
| Solubility | Soluble in DMSO > 10 mM |
| Storage | Store at -20°C |
| InChI | InChI=1S/C38H50O6/c1-22(2)11-13-27(25(7)8)20-37-21-28(15-12-23(3)4)36(9,10)38(35(37)44,18-17-24(5)6)34(43)31(33(37)42)32(41)26-14-16-29(39)30(40)19-26/h11-12,14,16-17,19,27-28,39-41H,7,13,15,18,20-21H2,1-6,8-10H3 |
| InChIKey | DTTONLKLWRTCAB-UHFFFAOYSA-N |
| SMILES | CC(=CCC1CC2(C(=O)C(=C(C3=CC(=C(C=C3)O)O)O)C(=O)C(C2=O)(C1(C)C)CC=C(C)C)CC(CC=C(C)C)C(=C)C)C |
| Reference | 1: Behera AK, Swamy MM, Natesh N, Kundu TK. Garcinol and Its Role in Chronic Diseases. Adv Exp Med Biol. 2016;928:435-452. Review. PubMed PMID: 27671827.<br /> |
