For research use only. Not for therapeutic Use.
GBT1118（Cat No.:I041177）is an investigational small molecule designed to treat sickle cell disease (SCD) by modulating the hemoglobin oxygen affinity. It works by increasing hemoglobin’s ability to bind and hold onto oxygen, reducing the polymerization of sickle hemoglobin, which is the primary cause of the sickling of red blood cells. This can help alleviate symptoms such as pain crises and improve overall blood flow. GBT1118 is being evaluated in clinical trials for its potential to improve patient outcomes, offering a promising therapeutic option for managing SCD and related complications.
| CAS Number | 1628799-51-8 |
| Synonyms | 2-hydroxy-6-[[(2S)-1-(pyridine-3-carbonyl)piperidin-2-yl]methoxy]benzaldehyde |
| Molecular Formula | C19H20N2O4 |
| Purity | ≥95% |
| IUPAC Name | 2-hydroxy-6-[[(2S)-1-(pyridine-3-carbonyl)piperidin-2-yl]methoxy]benzaldehyde |
| InChI | InChI=1S/C19H20N2O4/c22-12-16-17(23)7-3-8-18(16)25-13-15-6-1-2-10-21(15)19(24)14-5-4-9-20-11-14/h3-5,7-9,11-12,15,23H,1-2,6,10,13H2/t15-/m0/s1 |
| InChIKey | DIXJEEIWNGTEBR-HNNXBMFYSA-N |
| SMILES | C1CCN([C@@H](C1)COC2=CC=CC(=C2C=O)O)C(=O)C3=CN=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
