For research use only. Not for therapeutic Use.
GDC-0077 (Cat No.:I006937) is a highly selective inhibitor of the PI3K alpha (PI3Kα) isoform, which plays a crucial role in cell growth, proliferation, and survival. PI3Kα is frequently mutated in several cancers, including breast cancer, leading to abnormal activation of the PI3K/Akt/mTOR signaling pathway. By selectively targeting PI3Kα, GDC-0077 effectively inhibits tumor growth and induces apoptosis in cancer cells with PI3Kα mutations. This compound has shown promise in preclinical and clinical studies, particularly for treating hormone receptor-positive, HER2-negative breast cancer, and is being explored as a potential targeted cancer therapy.
Catalog Number | I006937 |
CAS Number | 2060571-02-8 |
Synonyms | GDC-0077; GDC 0077; GDC0077.;(S)-2-((2-((S)-4-(difluoromethyl)-2-oxooxazolidin-3-yl)-5,6-dihydrobenzo[f]imidazo[1,2-d][1,4]oxazepin-9-yl)amino)propanamide |
Molecular Formula | C18H19F2N5O4 |
Purity | ≥95% |
Target | Apoptosis |
Solubility | Soluble in DMSO |
Storage | 0 - 4°C for short term or -20 °C for long term |
IUPAC Name | (2S)-2-[[2-[(4S)-4-(difluoromethyl)-2-oxo-1,3-oxazolidin-3-yl]-5,6-dihydroimidazo[1,2-d][1,4]benzoxazepin-9-yl]amino]propanamide |
InChI | InChI=1S/C18H19F2N5O4/c1-9(16(21)26)22-10-2-3-11-13(6-10)28-5-4-24-7-14(23-17(11)24)25-12(15(19)20)8-29-18(25)27/h2-3,6-7,9,12,15,22H,4-5,8H2,1H3,(H2,21,26)/t9-,12-/m0/s1 |
InChIKey | SGEUNORSOZVTOL-CABZTGNLSA-N |
SMILES | C[C@@H](C(=O)N)NC1=CC2=C(C=C1)C3=NC(=CN3CCO2)N4[C@@H](COC4=O)C(F)F |