For research use only. Not for therapeutic Use.
GDC-0834 Racemate (Cat.No:I000499) is a racemic mixture of GDC-0834, a selective inhibitor of Bruton’s tyrosine kinase (BTK). BTK plays a crucial role in B-cell receptor signaling and is implicated in various B-cell malignancies. GDC-0834 Racemate has shown potential in preclinical studies as a targeted therapy for B-cell-related cancers. Clinical trials are ongoing to evaluate its safety and efficacy.
CAS Number | 1133432-46-8 |
Molecular Formula | C33H36N6O3S |
Purity | ≥95% |
Target | Btk |
Solubility | DMSO: ≥ 49 mg/mL |
Storage | Store at -20°C |
IC50 | 5.9 nM/6.4 nM(biochemical/cellular assay) [1] |
IUPAC Name | N-[3-[6-[4-(1,4-dimethyl-3-oxopiperazin-2-yl)anilino]-4-methyl-5-oxopyrazin-2-yl]-2-methylphenyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
InChI | InChI=1S/C33H36N6O3S/c1-20-24(9-7-10-25(20)36-31(40)28-18-22-8-5-6-11-27(22)43-28)26-19-39(4)33(42)30(35-26)34-23-14-12-21(13-15-23)29-32(41)38(3)17-16-37(29)2/h7,9-10,12-15,18-19,29H,5-6,8,11,16-17H2,1-4H3,(H,34,35)(H,36,40) |
InChIKey | CDOOFZZILLRUQH-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC=C1NC(=O)C2=CC3=C(S2)CCCC3)C4=CN(C(=O)C(=N4)NC5=CC=C(C=C5)C6C(=O)N(CCN6C)C)C |
Reference | <p style=/line-height:25px/> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |