For research use only. Not for therapeutic Use.
GDC-0941 Dimethanesulfonate(Cat No.:I005673)is a potent and selective inhibitor of class I phosphoinositide 3-kinase (PI3K), primarily targeting the PI3K/Akt/mTOR signaling pathway. This pathway plays a crucial role in regulating cell growth, proliferation, and survival, making GDC-0941 a valuable compound for cancer research. It has demonstrated significant antitumor activity in various preclinical models, particularly in breast and prostate cancers. GDC-0941 is also being explored in combination therapies to enhance its efficacy and overcome resistance mechanisms in targeted cancer treatments, contributing to advancements in precision oncology.
CAS Number | 957054-33-0 |
Synonyms | 4-[2-(1H-indazol-4-yl)-6-[(4-methylsulfonylpiperazin-1-yl)methyl]thieno[3,2-d]pyrimidin-4-yl]morpholine;methanesulfonic acid |
Molecular Formula | C₂₅H₃₅N₇O₉S₄ |
Purity | ≥95% |
Target | Autophagy |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IC50 | 3 nM |
IUPAC Name | 4-[2-(1H-indazol-4-yl)-6-[(4-methylsulfonylpiperazin-1-yl)methyl]thieno[3,2-d]pyrimidin-4-yl]morpholine;methanesulfonic acid |
InChI | InChI=1S/C23H27N7O3S2.2CH4O3S/c1-35(31,32)30-7-5-28(6-8-30)15-16-13-20-21(34-16)23(29-9-11-33-12-10-29)26-22(25-20)17-3-2-4-19-18(17)14-24-27-19;2*1-5(2,3)4/h2-4,13-14H,5-12,15H2,1H3,(H,24,27);2*1H3,(H,2,3,4) |
InChIKey | RFRIKACSFOTIMU-UHFFFAOYSA-N |
SMILES | CS(=O)(=O)N1CCN(CC1)CC2=CC3=C(S2)C(=NC(=N3)C4=C5C=NNC5=CC=C4)N6CCOCC6.CS(=O)(=O)O.CS(=O)(=O)O |
Reference | <p> |