For research use only. Not for therapeutic Use.
GDC-2394（Cat No.:I042637）is a small molecule inhibitor under investigation for its potential in treating cancer. It specifically targets and inhibits fibroblast growth factor receptor (FGFR) signaling, which is involved in tumor growth, angiogenesis, and metastasis. Dysregulated FGFR activity is often associated with various cancers, including breast, lung, and bladder cancer. By blocking FGFR, GDC-2394 aims to reduce tumor cell proliferation and inhibit cancer progression. Early preclinical studies have shown promise in inhibiting tumor growth, and ongoing clinical trials are evaluating its safety and efficacy as a targeted cancer therapy.
| CAS Number | 2238822-07-4 |
| Synonyms | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[(6S)-6-(methylamino)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]sulfonyl]urea |
| Molecular Formula | C20H25N5O4S |
| Purity | ≥95% |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[(6S)-6-(methylamino)-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]sulfonyl]urea |
| InChI | InChI=1S/C20H25N5O4S/c1-21-14-10-25-19(29-11-14)17(9-22-25)30(27,28)24-20(26)23-18-15-6-2-4-12(15)8-13-5-3-7-16(13)18/h8-9,14,21H,2-7,10-11H2,1H3,(H2,23,24,26)/t14-/m0/s1 |
| InChIKey | NDRARVKETDZHBS-AWEZNQCLSA-N |
| SMILES | CN[C@H]1CN2C(=C(C=N2)S(=O)(=O)NC(=O)NC3=C4CCCC4=CC5=C3CCC5)OC1 |
