For research use only. Not for therapeutic Use.
GDC-6599 (Example 8) is an orally active TRPA1 inhibitor. GDC-6599 can be used to study TRPA1-mediated diseases such as pain[1].
CAS Number | 2376824-99-4 |
Synonyms | 1-[[3-[(3R,5R)-5-(4-chlorophenyl)oxolan-3-yl]-1,2,4-oxadiazol-5-yl]methyl]-2,7-dimethylpurin-6-one |
Molecular Formula | C20H19ClN6O3 |
Purity | ≥95% |
InChI | InChI=1S/C20H19ClN6O3/c1-11-23-19-17(26(2)10-22-19)20(28)27(11)8-16-24-18(25-30-16)13-7-15(29-9-13)12-3-5-14(21)6-4-12/h3-6,10,13,15H,7-9H2,1-2H3/t13-,15+/m0/s1 |
InChIKey | FIBJEOLUMVIRIT-DZGCQCFKSA-N |
SMILES | CC1=NC2=C(C(=O)N1CC3=NC(=NO3)C4CC(OC4)C5=CC=C(C=C5)Cl)N(C=N2)C |
Reference | [1]. Jack Alexander Terrett, et al. Oxadiazole transient receptor potential channel inhibitors. Patent US20190284179A1. |