GDP366（Cat No.:I013334）is a selective and potent inhibitor of matrix metalloproteinases (MMPs), particularly MMP-9 and MMP-12, which are enzymes involved in the breakdown of extracellular matrix components. By inhibiting these MMPs, GDP366 holds therapeutic potential in treating various inflammatory and fibrotic diseases, including chronic obstructive pulmonary disease (COPD) and cancer. Its action helps to prevent tissue destruction and remodeling associated with these conditions. GDP366’s development reflects ongoing research efforts to manage disease progression through targeted intervention in pathological tissue degradation processes, providing a promising avenue for clinical applications.
| Catalog Number | I013334 |
| CAS Number | 501698-03-9 |
| Molecular Formula | C₂₀H₁₇N₅OS |
| Purity | ≥95% |
| Target | Survivin |
| Solubility | DMSO |
| IUPAC Name | 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-methylphenyl)urea |
| InChI | InChI=1S/C20H17N5OS/c1-12-3-2-4-15(9-12)25-20(26)24-14-7-5-13(6-8-14)16-10-27-19-17(16)18(21)22-11-23-19/h2-11H,1H3,(H2,21,22,23)(H2,24,25,26) |
| InChIKey | DZSUJUOJJJCWGG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)NC(=O)NC2=CC=C(C=C2)C3=CSC4=NC=NC(=C34)N |
