For research use only. Not for therapeutic Use.
Gedunin (Cat.No:I010757) is a natural compound found in the Indian neem tree. Known for its medicinal properties, gedunin has attracted attention for its potential anticancer and antimalarial effects. Studies suggest that gedunin exhibits promising activity against various cancer types and malaria parasites. Further research is underway to explore its therapeutic potential.
| Catalog Number | I010757 |
| CAS Number | 2753-30-2 |
| Synonyms | (1S,3aS,4aR,4bS,5R,6aR,10aR,10bR,12aS)-5-(Acetyloxy)-1-(3-furanyl)-1,5,6,6a,7,10a,10b,11,12,12a,decahydro-4b,7,7,10a,12a,-pentamethyloxireno[c]phenanthro[1,2-d]pyran-3,8(3aH,4bH)-dione |
| Molecular Formula | C28H34O7 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Solubility | Soluble to 100 mM in DMSO and to 10 mM in ethanol with gentle warming |
| Storage | Store at 4°C |
| IUPAC Name | [(1S,2R,4S,7S,8S,11R,12R,17R,19R)-7-(furan-3-yl)-1,8,12,16,16-pentamethyl-5,15-dioxo-3,6-dioxapentacyclo[9.8.0.02,4.02,8.012,17]nonadec-13-en-19-yl] acetate |
| InChI | InChI=1S/C28H34O7/c1-15(29)33-20-13-18-24(2,3)19(30)8-10-25(18,4)17-7-11-26(5)21(16-9-12-32-14-16)34-23(31)22-28(26,35-22)27(17,20)6/h8-10,12,14,17-18,20-22H,7,11,13H2,1-6H3/t17-,18+,20-,21+,22-,25-,26+,27+,28-/m1/s1 |
| InChIKey | YJXDGWUNRYLINJ-BHAPSIHVSA-N |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2[C@](C=CC(=O)C2(C)C)([C@@H]3[C@@]1([C@]45[C@H](O4)C(=O)O[C@H]([C@@]5(CC3)C)C6=COC=C6)C)C |
