For research use only. Not for therapeutic Use.
Gefitinib-d8(Cat No.:I017460) is a high-purity, deuterium-labeled compound essential for advanced pharmaceutical and biochemical research. Featuring eight deuterium atoms, this isotopically labeled version of Gefitinib is crucial for studies on cancer therapy, drug metabolism, and pharmacokinetics. Gefitinib-d8 aids in the development of targeted cancer therapies and enhances the understanding of epidermal growth factor receptor (EGFR) inhibition mechanisms, making it a valuable tool for scientific investigations and drug development.
Catalog Number | I017460 |
CAS Number | 857091-32-8 |
Molecular Formula | C₂₂H₁₆D₈ClFN₄O₃ |
Purity | ≥95% |
IUPAC Name | N-(3-chloro-4-fluorophenyl)-7-methoxy-6-[3-(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)propoxy]quinazolin-4-amine |
InChI | InChI=1S/C22H24ClFN4O3/c1-29-20-13-19-16(12-21(20)31-8-2-5-28-6-9-30-10-7-28)22(26-14-25-19)27-15-3-4-18(24)17(23)11-15/h3-4,11-14H,2,5-10H2,1H3,(H,25,26,27)/i6D2,7D2,9D2,10D2 |
InChIKey | XGALLCVXEZPNRQ-IHGLQNJRSA-N |
SMILES | [2H]C1(C(OC(C(N1CCCOC2=C(C=C3C(=C2)C(=NC=N3)NC4=CC(=C(C=C4)F)Cl)OC)([2H])[2H])([2H])[2H])([2H])[2H])[2H] |