For research use only. Not for therapeutic Use.
Gemcitabine HCl（Cat No.:A000811）is a nucleoside analog used as a chemotherapeutic agent for various cancers, including pancreatic, lung, and breast cancer. It inhibits DNA synthesis by incorporating into DNA and interfering with DNA polymerase, leading to apoptosis in rapidly dividing cancer cells. Gemcitabine also inhibits ribonucleotide reductase, depleting deoxynucleotide pools required for DNA replication. Its dual mechanism of action and broad-spectrum efficacy make it a cornerstone in oncology. Gemcitabine HCl is extensively studied for optimizing cancer treatment regimens, understanding resistance mechanisms, and developing combination therapies to enhance its therapeutic potential.
| Catalog Number | A000811 |
| CAS Number | 122111-03-9 |
| Synonyms | LY188011 |
| Molecular Formula | C9H11F2N3O4.HCI |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | Limited solubility |
| Storage | 3 years -20C powder |
| IUPAC Name | 4-amino-1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;hydrochloride |
| InChI | InChI=1S/C9H11F2N3O4.ClH/c10-9(11)6(16)4(3-15)18-7(9)14-2-1-5(12)13-8(14)17;/h1-2,4,6-7,15-16H,3H2,(H2,12,13,17);1H/t4-,6-,7-;/m1./s1 |
| InChIKey | OKKDEIYWILRZIA-OSZBKLCCSA-N |
| SMILES | C1=CN(C(=O)N=C1N)[C@H]2C([C@@H]([C@H](O2)CO)O)(F)F.Cl |
| Reference | <span style=”color:#000000;”><span style=”font-size:12px;”><span style=”font-family:arial,helvetica,sans-serif;”>1.Shi, Xin, et al. "Acquired resistance of pancreatic cancer cells towards 5-Fluorouracil and gemcitabine is associated with altered expression of apoptosis-regulating genes." <i style=”font-family: Arial, sans-serif; font-size: 13px;”>Oncology</i> 62.4 (2002): 354-362.<br /> |
