For research use only. Not for therapeutic Use.
Genistein 4’-β-D-glucopyranoside(Cat No.:R024091)is a naturally occurring isoflavone glucoside found in various plants, notably soybeans. This compound is known for its antioxidant and anti-inflammatory properties, contributing to its potential therapeutic benefits in preventing chronic diseases such as cancer, cardiovascular diseases, and osteoporosis. As a phytoestrogen, it plays a role in hormone regulation and bone health. High-purity Genistein 4’-β-D-glucopyranoside is essential for research in nutraceuticals and pharmaceuticals, providing reliable results in studies aimed at enhancing human health through natural compounds.
CAS Number | 152-95-4 |
Synonyms | Sophoricoside; 4’,5,7-Trihydroxyisoflavone 4’-β-D-Glucopyranoside; 5’,7’-Dihydroxy-4’-glucosyloxyisoflavone; Genistein 4’-O-Glucoside |
Molecular Formula | C21H20O10 |
Purity | ≥95% |
Target | Disease Research Fields |
IUPAC Name | 5,7-dihydroxy-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one |
InChI | InChI=1S/C21H20O10/c22-7-15-18(26)19(27)20(28)21(31-15)30-11-3-1-9(2-4-11)12-8-29-14-6-10(23)5-13(24)16(14)17(12)25/h1-6,8,15,18-24,26-28H,7H2/t15-,18-,19+,20-,21-/m1/s1 |
InChIKey | ISQRJFLLIDGZEP-CMWLGVBASA-N |
SMILES | C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)OC4C(C(C(C(O4)CO)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |