For research use only. Not for therapeutic Use.
Genistein (CAT: I003579) is a naturally occurring isoflavone compound found in various plants, particularly in soybeans. It possesses a range of pharmacologic activities and has been extensively studied for its potential health benefits. Genistein acts as a phytoestrogen, meaning it can bind to estrogen receptors and exert estrogen-like effects in the body. It also has antioxidant, anti-inflammatory, and anticancer properties. Genistein has shown potential in the prevention and management of several health conditions, including cardiovascular disease, osteoporosis, and certain types of cancer, such as breast and prostate cancer. Additionally, it has been investigated for its role in improving menopausal symptoms and bone health. Genistein represents a promising natural compound with diverse potential applications in health and medicine.
| Catalog Number | I003579 |
| CAS Number | 446-72-0 |
| Synonyms | 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| Molecular Formula | C₁₅H₁₀O₅ |
| Purity | ≥95% |
| Target | Protein Tyrosine Kinase/RTK |
| Solubility | DMSO: ≥ 33 mg/mL |
| Storage | -20℃ |
| IC50 | 37.5 uM( Topo II) |
| IUPAC Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| InChI | InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19/h1-7,16-18H |
| InChIKey | TZBJGXHYKVUXJN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O |
