For research use only. Not for therapeutic Use.
Genistin (Cat.No:I003937) is a phytoestrogen found in various plants, particularly in soybeans. It belongs to the class of isoflavones and has been studied for its potential health benefits. Genistin exhibits antioxidant and estrogenic properties, which may contribute to its role in promoting cardiovascular health and reducing the risk of certain diseases.
CAS Number | 529-59-9 |
Synonyms | NSC 5112 |
Molecular Formula | C₂₁H₂₀O₁₀ |
Purity | ≥95% |
Target | Apoptosis |
Solubility | DMSO: ≥ 43 mg/mL |
Storage | Store at -20°C |
IUPAC Name | 5-hydroxy-3-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
InChI | InChI=1S/C21H20O10/c22-7-15-18(26)19(27)20(28)21(31-15)30-11-5-13(24)16-14(6-11)29-8-12(17(16)25)9-1-3-10(23)4-2-9/h1-6,8,15,18-24,26-28H,7H2/t15-,18-,19+,20-,21-/m1/s1 |
InChIKey | ZCOLJUOHXJRHDI-CMWLGVBASA-N |
SMILES | C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)OC4C(C(C(C(O4)CO)O)O)O)O |
Reference | <p style=/line-height:25px/> |